C23H31ClN2O4 — CID 119663930
[4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-ethoxyphenoxy)phenyl]methanone;hydrochloride (PubChem CID 119663930) has the molecular formula C23H31ClN2O4 and a molecular weight of 434.96 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-ethoxyphenoxy)phenyl]methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-ethoxyphenoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119663930 |
| Molecular Formula | C23H31ClN2O4 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-[2-(2-ethoxyphenoxy)phenyl]methanone;hydrochloride |
| SMILES | CCOc1ccccc1Oc1ccccc1C(=O)N1CCC(OCCCN)CC1.Cl |
| InChI | InChI=1S/C23H30N2O4.ClH/c1-2-27-21-10-5-6-11-22(21)29-20-9-4-3-8-19(20)23(26)25-15-12-18(13-16-25)28-17-7-14-24;/h3-6,8-11,18H,2,7,12-17,24H2,1H3;1H |
| InChIKey | MBKIPASQXQQBAZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|