C19H26BrNO5 — CID 55393223
4-O-[2-(4-bromophenoxy)ethyl] 1-O-tert-butyl piperidine-1,4-dicarboxylate (PubChem CID 55393223) has the molecular formula C19H26BrNO5 and a molecular weight of 428.32 g/mol. Its IUPAC name is 4-O-[2-(4-bromophenoxy)ethyl] 1-O-tert-butyl piperidine-1,4-dicarboxylate.
| Compound Name | 4-O-[2-(4-bromophenoxy)ethyl] 1-O-tert-butyl piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 55393223 |
| Molecular Formula | C19H26BrNO5 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-O-[2-(4-bromophenoxy)ethyl] 1-O-tert-butyl piperidine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)OCCOc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H26BrNO5/c1-19(2,3)26-18(23)21-10-8-14(9-11-21)17(22)25-13-12-24-16-6-4-15(20)5-7-16/h4-7,14H,8-13H2,1-3H3 |
| InChIKey | KSNUNAOBTPJPGF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|