C13H23NO4S — CID 163304307
1-O-tert-butyl 4-O-(methylsulfanylmethyl) piperidine-1,4-dicarboxylate (PubChem CID 163304307) has the molecular formula C13H23NO4S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(methylsulfanylmethyl) piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-(methylsulfanylmethyl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 163304307 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-O-tert-butyl 4-O-(methylsulfanylmethyl) piperidine-1,4-dicarboxylate |
| SMILES | CSCOC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H23NO4S/c1-13(2,3)18-12(16)14-7-5-10(6-8-14)11(15)17-9-19-4/h10H,5-9H2,1-4H3 |
| InChIKey | VNOBPMXVGXNSHU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|