C23H44N4O5S — CID 158536482
tert-butyl 4-carbamothioylpiperidine-1-carboxylate;tert-butyl 4-carbamoylpiperidine-1-carboxylate;methane (PubChem CID 158536482) has the molecular formula C23H44N4O5S and a molecular weight of 488.70 g/mol. Its IUPAC name is tert-butyl 4-carbamothioylpiperidine-1-carboxylate;tert-butyl 4-carbamoylpiperidine-1-carboxylate;methane.
| Compound Name | tert-butyl 4-carbamothioylpiperidine-1-carboxylate;tert-butyl 4-carbamoylpiperidine-1-carboxylate;methane |
|---|---|
| PubChem CID | 158536482 |
| Molecular Formula | C23H44N4O5S |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | tert-butyl 4-carbamothioylpiperidine-1-carboxylate;tert-butyl 4-carbamoylpiperidine-1-carboxylate;methane |
| SMILES | C.CC(C)(C)OC(=O)N1CCC(C(N)=O)CC1.CC(C)(C)OC(=O)N1CCC(C(N)=S)CC1 |
| InChI | InChI=1S/C11H20N2O3.C11H20N2O2S.CH4/c1-11(2,3)16-10(15)13-6-4-8(5-7-13)9(12)14;1-11(2,3)15-10(14)13-6-4-8(5-7-13)9(12)16;/h8H,4-7H2,1-3H3,(H2,12,14);8H,4-7H2,1-3H3,(H2,12,16);1H4 |
| InChIKey | HNZUGWOTEBQQQP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|