C16H29N3O3S — CID 57189986
tert-butyl N-[(2R)-1-(4-carbamoylpiperidin-1-yl)-1-sulfanylidenepentan-2-yl]carbamate (PubChem CID 57189986) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-carbamoylpiperidin-1-yl)-1-sulfanylidenepentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-carbamoylpiperidin-1-yl)-1-sulfanylidenepentan-2-yl]carbamate |
|---|---|
| PubChem CID | 57189986 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-carbamoylpiperidin-1-yl)-1-sulfanylidenepentan-2-yl]carbamate |
| SMILES | CCC[C@@H](NC(=O)OC(C)(C)C)C(=S)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H29N3O3S/c1-5-6-12(18-15(21)22-16(2,3)4)14(23)19-9-7-11(8-10-19)13(17)20/h11-12H,5-10H2,1-4H3,(H2,17,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | ARQYHTIREDBBDH-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|