C11H20N2O3S — CID 142743306
tert-butyl (3R,4R)-3-carbamothioyl-4-hydroxypiperidine-1-carboxylate (PubChem CID 142743306) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-carbamothioyl-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-carbamothioyl-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142743306 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | tert-butyl (3R,4R)-3-carbamothioyl-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](O)[C@H](C(N)=S)C1 |
| InChI | InChI=1S/C11H20N2O3S/c1-11(2,3)16-10(15)13-5-4-8(14)7(6-13)9(12)17/h7-8,14H,4-6H2,1-3H3,(H2,12,17)/t7-,8-/m1/s1 |
| InChIKey | WRLADZAHUZDIPU-HTQZYQBOSA-N |
| XLogP | 0.89 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|