C21H27NO6 — CID 6568126
(8-methyl-2-oxo-4-propylchromen-7-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 6568126) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is (8-methyl-2-oxo-4-propylchromen-7-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (8-methyl-2-oxo-4-propylchromen-7-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 6568126 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (8-methyl-2-oxo-4-propylchromen-7-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCc1cc(=O)oc2c(C)c(OC(=O)[C@@H](C)NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C21H27NO6/c1-7-8-14-11-17(23)27-18-12(2)16(10-9-15(14)18)26-19(24)13(3)22-20(25)28-21(4,5)6/h9-11,13H,7-8H2,1-6H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | OHAGTWKUJOJSIC-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|