C22H27NO6 — CID 7506328
(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 7506328) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is (6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 7506328 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccc2c3c(c(=O)oc2c1C)CCC3 |
| InChI | InChI=1S/C22H27NO6/c1-6-16(23-21(26)29-22(3,4)5)20(25)27-17-11-10-14-13-8-7-9-15(13)19(24)28-18(14)12(17)2/h10-11,16H,6-9H2,1-5H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | CEJXOBGFCNZRRD-INIZCTEOSA-N |
| XLogP | 3.80 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|