C27H25NO6 — CID 2921306
(4-methyl-6-oxobenzo[c]chromen-3-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate (PubChem CID 2921306) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is (4-methyl-6-oxobenzo[c]chromen-3-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate.
| Compound Name | (4-methyl-6-oxobenzo[c]chromen-3-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 2921306 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (4-methyl-6-oxobenzo[c]chromen-3-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
| SMILES | Cc1c(OC(=O)C(NC(=O)OC(C)(C)C)c2ccccc2)ccc2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C27H25NO6/c1-16-21(15-14-19-18-12-8-9-13-20(18)24(29)33-23(16)19)32-25(30)22(17-10-6-5-7-11-17)28-26(31)34-27(2,3)4/h5-15,22H,1-4H3,(H,28,31) |
| InChIKey | GRBYIXCVVIQGEZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|