C25H29NO7S — CID 6575722
(8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (PubChem CID 6575722) has the molecular formula C25H29NO7S and a molecular weight of 487.57 g/mol. Its IUPAC name is (8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate.
| Compound Name | (8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 6575722 |
| Molecular Formula | C25H29NO7S |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
| SMILES | COc1ccc2c(c1)c(=O)oc1c(C)c(OC(=O)[C@@H](CCSC)NC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C25H29NO7S/c1-14-20(31-23(28)19(11-12-34-6)26-24(29)33-25(2,3)4)10-9-17-16-8-7-15(30-5)13-18(16)22(27)32-21(14)17/h7-10,13,19H,11-12H2,1-6H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | IVWKIEICWULUGC-LJQANCHMSA-N |
| XLogP | 4.82 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|