C28H27NO7S — CID 3801278
(8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) 4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 3801278) has the molecular formula C28H27NO7S and a molecular weight of 521.59 g/mol. Its IUPAC name is (8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) 4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) 4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 3801278 |
| Molecular Formula | C28H27NO7S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | (8-methoxy-4-methyl-6-oxobenzo[c]chromen-3-yl) 4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COc1ccc2c(c1)c(=O)oc1c(C)c(OC(=O)C(CCSC)NC(=O)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C28H27NO7S/c1-17-24(12-11-21-20-10-9-19(33-2)15-22(20)26(30)36-25(17)21)35-27(31)23(13-14-37-3)29-28(32)34-16-18-7-5-4-6-8-18/h4-12,15,23H,13-14,16H2,1-3H3,(H,29,32) |
| InChIKey | ZJDJWBJNZHGFSJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|