C30H23NO6 — CID 3344720
(4-methyl-6-oxobenzo[c]chromen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 3344720) has the molecular formula C30H23NO6 and a molecular weight of 493.52 g/mol. Its IUPAC name is (4-methyl-6-oxobenzo[c]chromen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | (4-methyl-6-oxobenzo[c]chromen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 3344720 |
| Molecular Formula | C30H23NO6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | (4-methyl-6-oxobenzo[c]chromen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | Cc1c(OC(=O)C(NC(=O)OCc2ccccc2)c2ccccc2)ccc2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C30H23NO6/c1-19-25(17-16-23-22-14-8-9-15-24(22)28(32)37-27(19)23)36-29(33)26(21-12-6-3-7-13-21)31-30(34)35-18-20-10-4-2-5-11-20/h2-17,26H,18H2,1H3,(H,31,34) |
| InChIKey | LRBSQUNJRNFYIY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|