C30H23NO7 — CID 73400070
(1-hydroxy-5-methyl-9-oxoxanthen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 73400070) has the molecular formula C30H23NO7 and a molecular weight of 509.51 g/mol. Its IUPAC name is (1-hydroxy-5-methyl-9-oxoxanthen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | (1-hydroxy-5-methyl-9-oxoxanthen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 73400070 |
| Molecular Formula | C30H23NO7 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (1-hydroxy-5-methyl-9-oxoxanthen-3-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | Cc1cccc2c(=O)c3c(O)cc(OC(=O)C(NC(=O)OCc4ccccc4)c4ccccc4)cc3oc12 |
| InChI | InChI=1S/C30H23NO7/c1-18-9-8-14-22-27(33)25-23(32)15-21(16-24(25)38-28(18)22)37-29(34)26(20-12-6-3-7-13-20)31-30(35)36-17-19-10-4-2-5-11-19/h2-16,26,32H,17H2,1H3,(H,31,35) |
| InChIKey | VEABXIZFGGXKBL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|