C25H19NO6 — CID 3707296
(2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 3707296) has the molecular formula C25H19NO6 and a molecular weight of 429.43 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | (2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 3707296 |
| Molecular Formula | C25H19NO6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | O=C(NC(C(=O)Oc1ccc2ccc(=O)oc2c1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H19NO6/c27-22-14-12-18-11-13-20(15-21(18)32-22)31-24(28)23(19-9-5-2-6-10-19)26-25(29)30-16-17-7-3-1-4-8-17/h1-15,23H,16H2,(H,26,29) |
| InChIKey | XFLVOZLOPPWUQG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|