C24H19NO6S — CID 3491650
(2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate (PubChem CID 3491650) has the molecular formula C24H19NO6S and a molecular weight of 449.48 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate.
| Compound Name | (2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 3491650 |
| Molecular Formula | C24H19NO6S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(=O)Oc2ccc3ccc(=O)oc3c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19NO6S/c1-16-7-12-20(13-8-16)32(28,29)25-23(18-5-3-2-4-6-18)24(27)30-19-11-9-17-10-14-22(26)31-21(17)15-19/h2-15,23,25H,1H3 |
| InChIKey | CALAKCFBSGTYPW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|