C28H25NO6 — CID 3755924
(3,4,8-trimethyl-2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 3755924) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is (3,4,8-trimethyl-2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | (3,4,8-trimethyl-2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 3755924 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (3,4,8-trimethyl-2-oxochromen-7-yl) 2-phenyl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | Cc1c(C)c2ccc(OC(=O)C(NC(=O)OCc3ccccc3)c3ccccc3)c(C)c2oc1=O |
| InChI | InChI=1S/C28H25NO6/c1-17-18(2)26(30)35-25-19(3)23(15-14-22(17)25)34-27(31)24(21-12-8-5-9-13-21)29-28(32)33-16-20-10-6-4-7-11-20/h4-15,24H,16H2,1-3H3,(H,29,32) |
| InChIKey | TYVFPZCVXVUMMH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|