C29H35NO6 — CID 92509291
(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 92509291) has the molecular formula C29H35NO6 and a molecular weight of 493.60 g/mol. Its IUPAC name is (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 92509291 |
| Molecular Formula | C29H35NO6 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccc2c(C)c(Cc3ccccc3)c(=O)oc2c1C |
| InChI | InChI=1S/C29H35NO6/c1-8-17(2)24(30-28(33)36-29(5,6)7)27(32)34-23-15-14-21-18(3)22(16-20-12-10-9-11-13-20)26(31)35-25(21)19(23)4/h9-15,17,24H,8,16H2,1-7H3,(H,30,33)/t17-,24+/m0/s1 |
| InChIKey | LTJQMRYNQCFUKO-BXKMTCNYSA-N |
| XLogP | 5.85 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|