C33H29NO6 — CID 130455879
(4-methyl-6-oxobenzo[c]chromen-3-yl) 5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 130455879) has the molecular formula C33H29NO6 and a molecular weight of 535.60 g/mol. Its IUPAC name is (4-methyl-6-oxobenzo[c]chromen-3-yl) 5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (4-methyl-6-oxobenzo[c]chromen-3-yl) 5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 130455879 |
| Molecular Formula | C33H29NO6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | (4-methyl-6-oxobenzo[c]chromen-3-yl) 5-phenyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | Cc1c(OC(=O)C(CCCc2ccccc2)NC(=O)OCc2ccccc2)ccc2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C33H29NO6/c1-22-29(20-19-26-25-16-8-9-17-27(25)31(35)40-30(22)26)39-32(36)28(18-10-15-23-11-4-2-5-12-23)34-33(37)38-21-24-13-6-3-7-14-24/h2-9,11-14,16-17,19-20,28H,10,15,18,21H2,1H3,(H,34,37) |
| InChIKey | OYLWVBBFFMAPDL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|