C22H23N3O7 — CID 3441402
5-(carbamoylamino)-2-[[2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetyl]amino]pentanoic acid (PubChem CID 3441402) has the molecular formula C22H23N3O7 and a molecular weight of 441.44 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-[[2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetyl]amino]pentanoic acid.
| Compound Name | 5-(carbamoylamino)-2-[[2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 3441402 |
| Molecular Formula | C22H23N3O7 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 5-(carbamoylamino)-2-[[2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetyl]amino]pentanoic acid |
| SMILES | Cc1c(OCC(=O)NC(CCCNC(N)=O)C(=O)O)ccc2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C22H23N3O7/c1-12-17(9-8-14-13-5-2-3-6-15(13)21(29)32-19(12)14)31-11-18(26)25-16(20(27)28)7-4-10-24-22(23)30/h2-3,5-6,8-9,16H,4,7,10-11H2,1H3,(H,25,26)(H,27,28)(H3,23,24,30) |
| InChIKey | PQFYKVVBDPNVMA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|