C16H15NO5 — CID 51059911
2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetamide;hydrate (PubChem CID 51059911) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetamide;hydrate.
| Compound Name | 2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetamide;hydrate |
|---|---|
| PubChem CID | 51059911 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetamide;hydrate |
| SMILES | Cc1c(OCC(N)=O)ccc2c1oc(=O)c1ccccc12.O |
| InChI | InChI=1S/C16H13NO4.H2O/c1-9-13(20-8-14(17)18)7-6-11-10-4-2-3-5-12(10)16(19)21-15(9)11;/h2-7H,8H2,1H3,(H2,17,18);1H2 |
| InChIKey | MBFPFSKNUNNRHB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|