C21H15O6- — CID 7001864
5-methyl-4-[(4-methyl-6-oxobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate (PubChem CID 7001864) has the molecular formula C21H15O6- and a molecular weight of 363.35 g/mol. Its IUPAC name is 5-methyl-4-[(4-methyl-6-oxobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate.
| Compound Name | 5-methyl-4-[(4-methyl-6-oxobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7001864 |
| Molecular Formula | C21H15O6- |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 5-methyl-4-[(4-methyl-6-oxobenzo[c]chromen-3-yl)oxymethyl]furan-2-carboxylate |
| SMILES | Cc1oc(C(=O)[O-])cc1COc1ccc2c(oc(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C21H16O6/c1-11-17(25-10-13-9-18(20(22)23)26-12(13)2)8-7-15-14-5-3-4-6-16(14)21(24)27-19(11)15/h3-9H,10H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | IUOQTIBTHSSQTI-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 92.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|