C23H25NO7 — CID 40944071
(1-hydroxy-5-methyl-9-oxoxanthen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 40944071) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is (1-hydroxy-5-methyl-9-oxoxanthen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (1-hydroxy-5-methyl-9-oxoxanthen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 40944071 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (1-hydroxy-5-methyl-9-oxoxanthen-3-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC[C@@H](NC(=O)OC(C)(C)C)C(=O)Oc1cc(O)c2c(=O)c3cccc(C)c3oc2c1 |
| InChI | InChI=1S/C23H25NO7/c1-6-15(24-22(28)31-23(3,4)5)21(27)29-13-10-16(25)18-17(11-13)30-20-12(2)8-7-9-14(20)19(18)26/h7-11,15,25H,6H2,1-5H3,(H,24,28)/t15-/m1/s1 |
| InChIKey | YKAQZWWZTUCFFG-OAHLLOKOSA-N |
| XLogP | 4.17 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|