C25H21NO7 — CID 40943653
(1-hydroxy-9-oxoxanthen-3-yl) (2S)-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 40943653) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is (1-hydroxy-9-oxoxanthen-3-yl) (2S)-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (1-hydroxy-9-oxoxanthen-3-yl) (2S)-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 40943653 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (1-hydroxy-9-oxoxanthen-3-yl) (2S)-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1cc(O)c2c(=O)c3ccccc3oc2c1 |
| InChI | InChI=1S/C25H21NO7/c1-2-18(26-25(30)31-14-15-8-4-3-5-9-15)24(29)32-16-12-19(27)22-21(13-16)33-20-11-7-6-10-17(20)23(22)28/h3-13,18,27H,2,14H2,1H3,(H,26,30)/t18-/m0/s1 |
| InChIKey | UMJIVCDZHGORSD-SFHVURJKSA-N |
| XLogP | 4.26 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|