C13H8O4 — CID 5488193
1,3-dihydroxyxanthen-9-one (PubChem CID 5488193) has the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. Its IUPAC name is 1,3-dihydroxyxanthen-9-one.
| Compound Name | 1,3-dihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 5488193 |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1,3-dihydroxyxanthen-9-one |
| SMILES | O=c1c2ccccc2oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C13H8O4/c14-7-5-9(15)12-11(6-7)17-10-4-2-1-3-8(10)13(12)16/h1-6,14-15H |
| InChIKey | GTHOERCJZSJGHB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|