C23H14O7 — CID 54576745
1,3,6,8-tetrahydroxy-2-(2-hydroxynaphthalen-1-yl)xanthen-9-one (PubChem CID 54576745) has the molecular formula C23H14O7 and a molecular weight of 402.36 g/mol. Its IUPAC name is 1,3,6,8-tetrahydroxy-2-(2-hydroxynaphthalen-1-yl)xanthen-9-one.
| Compound Name | 1,3,6,8-tetrahydroxy-2-(2-hydroxynaphthalen-1-yl)xanthen-9-one |
|---|---|
| PubChem CID | 54576745 |
| Molecular Formula | C23H14O7 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1,3,6,8-tetrahydroxy-2-(2-hydroxynaphthalen-1-yl)xanthen-9-one |
| SMILES | O=c1c2c(O)cc(O)cc2oc2cc(O)c(-c3c(O)ccc4ccccc34)c(O)c12 |
| InChI | InChI=1S/C23H14O7/c24-11-7-14(26)19-16(8-11)30-17-9-15(27)20(23(29)21(17)22(19)28)18-12-4-2-1-3-10(12)5-6-13(18)25/h1-9,24-27,29H |
| InChIKey | GZOATUSXNQZYRY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|