C16H14O6 — CID 162673703
2,3,6,8-tetrahydroxy-1-propylxanthen-9-one (PubChem CID 162673703) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,3,6,8-tetrahydroxy-1-propylxanthen-9-one.
| Compound Name | 2,3,6,8-tetrahydroxy-1-propylxanthen-9-one |
|---|---|
| PubChem CID | 162673703 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2,3,6,8-tetrahydroxy-1-propylxanthen-9-one |
| SMILES | CCCc1c(O)c(O)cc2oc3cc(O)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C16H14O6/c1-2-3-8-13-12(6-10(19)15(8)20)22-11-5-7(17)4-9(18)14(11)16(13)21/h4-6,17-20H,2-3H2,1H3 |
| InChIKey | QKZFAPRZDGEOJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|