C15H12O4 — CID 164763934
3-ethyl-1,8-dihydroxyxanthen-9-one (PubChem CID 164763934) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-ethyl-1,8-dihydroxyxanthen-9-one.
| Compound Name | 3-ethyl-1,8-dihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 164763934 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-ethyl-1,8-dihydroxyxanthen-9-one |
| SMILES | CCc1cc(O)c2c(=O)c3c(O)cccc3oc2c1 |
| InChI | InChI=1S/C15H12O4/c1-2-8-6-10(17)14-12(7-8)19-11-5-3-4-9(16)13(11)15(14)18/h3-7,16-17H,2H2,1H3 |
| InChIKey | WOLYETOBYHAAGW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|