C17H16O6 — CID 86054399
1,8-dihydroxy-3-(3-hydroxybutoxy)xanthen-9-one (PubChem CID 86054399) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1,8-dihydroxy-3-(3-hydroxybutoxy)xanthen-9-one.
| Compound Name | 1,8-dihydroxy-3-(3-hydroxybutoxy)xanthen-9-one |
|---|---|
| PubChem CID | 86054399 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1,8-dihydroxy-3-(3-hydroxybutoxy)xanthen-9-one |
| SMILES | CC(O)CCOc1cc(O)c2c(=O)c3c(O)cccc3oc2c1 |
| InChI | InChI=1S/C17H16O6/c1-9(18)5-6-22-10-7-12(20)16-14(8-10)23-13-4-2-3-11(19)15(13)17(16)21/h2-4,7-9,18-20H,5-6H2,1H3 |
| InChIKey | BVGCPICXZZPKED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|