C33H45NO7 — CID 140638726
2-[5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-2-[1-(tributylazaniumyl)butyl]chromen-7-yl]oxyacetate (PubChem CID 140638726) has the molecular formula C33H45NO7 and a molecular weight of 567.72 g/mol. Its IUPAC name is 2-[5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-2-[1-(tributylazaniumyl)butyl]chromen-7-yl]oxyacetate.
| Compound Name | 2-[5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-2-[1-(tributylazaniumyl)butyl]chromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 140638726 |
| Molecular Formula | C33H45NO7 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | 2-[5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-2-[1-(tributylazaniumyl)butyl]chromen-7-yl]oxyacetate |
| SMILES | CCCC[N+](CCCC)(CCCC)C(CCC)c1oc2cc(OCC(=O)[O-])cc(O)c2c(=O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C33H45NO7/c1-5-9-17-34(18-10-6-2,19-11-7-3)26(12-8-4)33-30(23-13-15-24(35)16-14-23)32(39)31-27(36)20-25(21-28(31)41-33)40-22-29(37)38/h13-16,20-21,26H,5-12,17-19,22H2,1-4H3,(H2-,35,36,37,38,39) |
| InChIKey | FZEYTYVQNVJAOU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|