C35H32O7 — CID 10370669
7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-5-hydroxy-2,3-diphenylchromen-4-one (PubChem CID 10370669) has the molecular formula C35H32O7 and a molecular weight of 564.63 g/mol. Its IUPAC name is 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-5-hydroxy-2,3-diphenylchromen-4-one.
| Compound Name | 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-5-hydroxy-2,3-diphenylchromen-4-one |
|---|---|
| PubChem CID | 10370669 |
| Molecular Formula | C35H32O7 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-5-hydroxy-2,3-diphenylchromen-4-one |
| SMILES | CCCc1c(OCCCOc2cc(O)c3c(=O)c(-c4ccccc4)c(-c4ccccc4)oc3c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C35H32O7/c1-3-11-27-29(17-16-26(22(2)36)33(27)38)41-19-10-18-40-25-20-28(37)32-30(21-25)42-35(24-14-8-5-9-15-24)31(34(32)39)23-12-6-4-7-13-23/h4-9,12-17,20-21,37-38H,3,10-11,18-19H2,1-2H3 |
| InChIKey | PMOSSMRPVORIBR-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|