C25H33NO5 — CID 70448026
1-[4-[3-(4-acetyl-3-amino-5-propylphenoxy)propoxy]-2-hydroxy-3-propylphenyl]ethanone (PubChem CID 70448026) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-[4-[3-(4-acetyl-3-amino-5-propylphenoxy)propoxy]-2-hydroxy-3-propylphenyl]ethanone.
| Compound Name | 1-[4-[3-(4-acetyl-3-amino-5-propylphenoxy)propoxy]-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 70448026 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-[4-[3-(4-acetyl-3-amino-5-propylphenoxy)propoxy]-2-hydroxy-3-propylphenyl]ethanone |
| SMILES | CCCc1cc(OCCCOc2ccc(C(C)=O)c(O)c2CCC)cc(N)c1C(C)=O |
| InChI | InChI=1S/C25H33NO5/c1-5-8-18-14-19(15-22(26)24(18)17(4)28)30-12-7-13-31-23-11-10-20(16(3)27)25(29)21(23)9-6-2/h10-11,14-15,29H,5-9,12-13,26H2,1-4H3 |
| InChIKey | BWCHJWYDONAUPP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|