C33H40O10 — CID 23318397
4-[8-acetyl-7-[2-[2-[2-(4-acetyl-3-hydroxy-2-propylphenoxy)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxybutanoic acid (PubChem CID 23318397) has the molecular formula C33H40O10 and a molecular weight of 596.67 g/mol. Its IUPAC name is 4-[8-acetyl-7-[2-[2-[2-(4-acetyl-3-hydroxy-2-propylphenoxy)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxybutanoic acid.
| Compound Name | 4-[8-acetyl-7-[2-[2-[2-(4-acetyl-3-hydroxy-2-propylphenoxy)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 23318397 |
| Molecular Formula | C33H40O10 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 4-[8-acetyl-7-[2-[2-[2-(4-acetyl-3-hydroxy-2-propylphenoxy)ethoxy]ethoxy]ethoxy]naphthalen-2-yl]oxybutanoic acid |
| SMILES | CCCc1c(OCCOCCOCCOc2ccc3ccc(OCCCC(=O)O)cc3c2C(C)=O)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C33H40O10/c1-4-6-27-29(13-11-26(22(2)34)33(27)38)42-19-17-39-15-16-40-18-20-43-30-12-9-24-8-10-25(41-14-5-7-31(36)37)21-28(24)32(30)23(3)35/h8-13,21,38H,4-7,14-20H2,1-3H3,(H,36,37) |
| InChIKey | XIRJGONKSYZZBD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|