C18H25BrO5 — CID 21286995
4-[4-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoic acid (PubChem CID 21286995) has the molecular formula C18H25BrO5 and a molecular weight of 401.30 g/mol. Its IUPAC name is 4-[4-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoic acid.
| Compound Name | 4-[4-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 21286995 |
| Molecular Formula | C18H25BrO5 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-[4-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoic acid |
| SMILES | CCCc1c(OCCCC(=O)O)ccc(C(C)=O)c1OCCCBr |
| InChI | InChI=1S/C18H25BrO5/c1-3-6-15-16(23-11-4-7-17(21)22)9-8-14(13(2)20)18(15)24-12-5-10-19/h8-9H,3-7,10-12H2,1-2H3,(H,21,22) |
| InChIKey | NGWSTTNNCKXFAL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|