C20H29BrO5 — CID 139635880
ethyl 4-[6-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoate (PubChem CID 139635880) has the molecular formula C20H29BrO5 and a molecular weight of 429.35 g/mol. Its IUPAC name is ethyl 4-[6-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoate.
| Compound Name | ethyl 4-[6-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoate |
|---|---|
| PubChem CID | 139635880 |
| Molecular Formula | C20H29BrO5 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | ethyl 4-[6-acetyl-3-(3-bromopropoxy)-2-propylphenoxy]butanoate |
| SMILES | CCCc1c(OCCCBr)ccc(C(C)=O)c1OCCCC(=O)OCC |
| InChI | InChI=1S/C20H29BrO5/c1-4-8-17-18(25-14-7-12-21)11-10-16(15(3)22)20(17)26-13-6-9-19(23)24-5-2/h10-11H,4-9,12-14H2,1-3H3 |
| InChIKey | BJZCFUASEFSJSW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|