C21H25BrO3 — CID 13368603
1-[4-[[4-(3-bromopropyl)phenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone (PubChem CID 13368603) has the molecular formula C21H25BrO3 and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-[4-[[4-(3-bromopropyl)phenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone.
| Compound Name | 1-[4-[[4-(3-bromopropyl)phenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 13368603 |
| Molecular Formula | C21H25BrO3 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-[4-[[4-(3-bromopropyl)phenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone |
| SMILES | CCCc1c(OCc2ccc(CCCBr)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C21H25BrO3/c1-3-5-19-20(12-11-18(15(2)23)21(19)24)25-14-17-9-7-16(8-10-17)6-4-13-22/h7-12,24H,3-6,13-14H2,1-2H3 |
| InChIKey | HXLWEDJWPJODBT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|