C17H24NO3S- — CID 21294042
1-(2-hydroxy-4-pentoxy-3-propylphenyl)ethanone thiocyanate (PubChem CID 21294042) has the molecular formula C17H24NO3S- and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-(2-hydroxy-4-pentoxy-3-propylphenyl)ethanone thiocyanate.
| Compound Name | 1-(2-hydroxy-4-pentoxy-3-propylphenyl)ethanone thiocyanate |
|---|---|
| PubChem CID | 21294042 |
| Molecular Formula | C17H24NO3S- |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-(2-hydroxy-4-pentoxy-3-propylphenyl)ethanone thiocyanate |
| SMILES | CCCCCOc1ccc(C(C)=O)c(O)c1CCC.N#C[S-] |
| InChI | InChI=1S/C16H24O3.CHNS/c1-4-6-7-11-19-15-10-9-13(12(3)17)16(18)14(15)8-5-2;2-1-3/h9-10,18H,4-8,11H2,1-3H3;3H/p-1 |
| InChIKey | KGGQPZKQXRBWOH-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|