C20H32N2O4 — CID 94036703
1-[2-hydroxy-4-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-3-propylphenyl]ethanone (PubChem CID 94036703) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[2-hydroxy-4-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-3-propylphenyl]ethanone.
| Compound Name | 1-[2-hydroxy-4-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 94036703 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-[2-hydroxy-4-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-3-propylphenyl]ethanone |
| SMILES | CCCc1c(OCCCN2CCN(CCO)CC2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C20H32N2O4/c1-3-5-18-19(7-6-17(16(2)24)20(18)25)26-15-4-8-21-9-11-22(12-10-21)13-14-23/h6-7,23,25H,3-5,8-15H2,1-2H3 |
| InChIKey | VHTUZKBCFGIVQU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|