C24H28O7 — CID 13019340
4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxy-3-prop-2-enylbenzoic acid (PubChem CID 13019340) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is 4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxy-3-prop-2-enylbenzoic acid.
| Compound Name | 4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxy-3-prop-2-enylbenzoic acid |
|---|---|
| PubChem CID | 13019340 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxy-3-prop-2-enylbenzoic acid |
| SMILES | C=CCc1c(OCCCOc2ccc(C(C)=O)c(O)c2CCC)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C24H28O7/c1-4-7-17-20(11-9-16(15(3)25)22(17)26)30-13-6-14-31-21-12-10-19(24(28)29)23(27)18(21)8-5-2/h5,9-12,26-27H,2,4,6-8,13-14H2,1,3H3,(H,28,29) |
| InChIKey | DZUCCRTWNBGXDK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|