C21H22O8 — CID 19004486
2-hydroxy-4-[3-(4-oxalophenoxy)propoxy]-3-propylbenzoic acid (PubChem CID 19004486) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-hydroxy-4-[3-(4-oxalophenoxy)propoxy]-3-propylbenzoic acid.
| Compound Name | 2-hydroxy-4-[3-(4-oxalophenoxy)propoxy]-3-propylbenzoic acid |
|---|---|
| PubChem CID | 19004486 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-hydroxy-4-[3-(4-oxalophenoxy)propoxy]-3-propylbenzoic acid |
| SMILES | CCCc1c(OCCCOc2ccc(C(=O)C(=O)O)cc2)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C21H22O8/c1-2-4-15-17(10-9-16(19(15)23)20(24)25)29-12-3-11-28-14-7-5-13(6-8-14)18(22)21(26)27/h5-10,23H,2-4,11-12H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | HKNIIMDWMZICNM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|