C28H30O6S — CID 11167836
2-[3-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butoxy]phenyl]sulfanylbenzoic acid (PubChem CID 11167836) has the molecular formula C28H30O6S and a molecular weight of 494.61 g/mol. Its IUPAC name is 2-[3-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butoxy]phenyl]sulfanylbenzoic acid.
| Compound Name | 2-[3-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butoxy]phenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 11167836 |
| Molecular Formula | C28H30O6S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-[3-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butoxy]phenyl]sulfanylbenzoic acid |
| SMILES | CCCc1c(OCCCCOc2cccc(Sc3ccccc3C(=O)O)c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C28H30O6S/c1-3-9-23-25(15-14-22(19(2)29)27(23)30)34-17-7-6-16-33-20-10-8-11-21(18-20)35-26-13-5-4-12-24(26)28(31)32/h4-5,8,10-15,18,30H,3,6-7,9,16-17H2,1-2H3,(H,31,32) |
| InChIKey | CULPUIMXWHATOA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|