C27H28O7 — CID 70501692
4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxybenzoic acid;bicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 70501692) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is 4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxybenzoic acid;bicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | 4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxybenzoic acid;bicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 70501692 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-2-hydroxybenzoic acid;bicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | CCCc1c(OCCCOc2ccc(C(=O)O)c(O)c2)ccc(C(C)=O)c1O.c1cc2ccc1-2 |
| InChI | InChI=1S/C21H24O7.C6H4/c1-3-5-17-19(9-8-15(13(2)22)20(17)24)28-11-4-10-27-14-6-7-16(21(25)26)18(23)12-14;1-2-6-4-3-5(1)6/h6-9,12,23-24H,3-5,10-11H2,1-2H3,(H,25,26);1-4H |
| InChIKey | OOSOWFLEKMHNRR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|