C14H20O5 — CID 70485136
1-[4-(3,3-dihydroxypropoxy)-2-hydroxy-3-propylphenyl]ethanone (PubChem CID 70485136) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-[4-(3,3-dihydroxypropoxy)-2-hydroxy-3-propylphenyl]ethanone.
| Compound Name | 1-[4-(3,3-dihydroxypropoxy)-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 70485136 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[4-(3,3-dihydroxypropoxy)-2-hydroxy-3-propylphenyl]ethanone |
| SMILES | CCCc1c(OCCC(O)O)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C14H20O5/c1-3-4-11-12(19-8-7-13(16)17)6-5-10(9(2)15)14(11)18/h5-6,13,16-18H,3-4,7-8H2,1-2H3 |
| InChIKey | ILXCHQSKPXFTPD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|