C22H27ClO7 — CID 21247296
acetic acid;1-[4-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-2-hydroxy-3-propylphenyl]ethanone (PubChem CID 21247296) has the molecular formula C22H27ClO7 and a molecular weight of 438.90 g/mol. Its IUPAC name is acetic acid;1-[4-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-2-hydroxy-3-propylphenyl]ethanone.
| Compound Name | acetic acid;1-[4-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 21247296 |
| Molecular Formula | C22H27ClO7 |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | acetic acid;1-[4-[3-(2-chlorophenoxy)-2-hydroxypropoxy]-2-hydroxy-3-propylphenyl]ethanone |
| SMILES | CC(=O)O.CCCc1c(OCC(O)COc2ccccc2Cl)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C20H23ClO5.C2H4O2/c1-3-6-16-18(10-9-15(13(2)22)20(16)24)25-11-14(23)12-26-19-8-5-4-7-17(19)21;1-2(3)4/h4-5,7-10,14,23-24H,3,6,11-12H2,1-2H3;1H3,(H,3,4) |
| InChIKey | HJFGCXDPTXGYKC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |