C23H27ClO6 — CID 54514191
methyl 2-[4-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)propan-2-yloxy]-3-chlorophenyl]acetate (PubChem CID 54514191) has the molecular formula C23H27ClO6 and a molecular weight of 434.92 g/mol. Its IUPAC name is methyl 2-[4-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)propan-2-yloxy]-3-chlorophenyl]acetate.
| Compound Name | methyl 2-[4-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)propan-2-yloxy]-3-chlorophenyl]acetate |
|---|---|
| PubChem CID | 54514191 |
| Molecular Formula | C23H27ClO6 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | methyl 2-[4-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)propan-2-yloxy]-3-chlorophenyl]acetate |
| SMILES | CCCc1c(OCC(C)Oc2ccc(CC(=O)OC)cc2Cl)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H27ClO6/c1-5-6-18-20(10-8-17(15(3)25)23(18)27)29-13-14(2)30-21-9-7-16(11-19(21)24)12-22(26)28-4/h7-11,14,27H,5-6,12-13H2,1-4H3 |
| InChIKey | YLGGNWQEZXJXDQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |