C25H33ClO4S — CID 57148045
methyl 2-[4-[3-(4-butyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-chlorophenyl]acetate (PubChem CID 57148045) has the molecular formula C25H33ClO4S and a molecular weight of 465.06 g/mol. Its IUPAC name is methyl 2-[4-[3-(4-butyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-chlorophenyl]acetate.
| Compound Name | methyl 2-[4-[3-(4-butyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-chlorophenyl]acetate |
|---|---|
| PubChem CID | 57148045 |
| Molecular Formula | C25H33ClO4S |
| Molecular Weight | 465.06 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | methyl 2-[4-[3-(4-butyl-3-hydroxy-2-propylphenoxy)propylsulfanyl]-3-chlorophenyl]acetate |
| SMILES | CCCCc1ccc(OCCCSc2ccc(CC(=O)OC)cc2Cl)c(CCC)c1O |
| InChI | InChI=1S/C25H33ClO4S/c1-4-6-9-19-11-12-22(20(8-5-2)25(19)28)30-14-7-15-31-23-13-10-18(16-21(23)26)17-24(27)29-3/h10-13,16,28H,4-9,14-15,17H2,1-3H3 |
| InChIKey | LSYIISAWUYZUEK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.06 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|