C24H28ClNO5S — CID 173217101
methyl 2-[3-chloro-4-[3-[(3-methoxyimino-7-propyl-1-benzofuran-6-yl)oxy]propylsulfanyl]phenyl]acetate (PubChem CID 173217101) has the molecular formula C24H28ClNO5S and a molecular weight of 478.01 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-[3-[(3-methoxyimino-7-propyl-1-benzofuran-6-yl)oxy]propylsulfanyl]phenyl]acetate.
| Compound Name | methyl 2-[3-chloro-4-[3-[(3-methoxyimino-7-propyl-1-benzofuran-6-yl)oxy]propylsulfanyl]phenyl]acetate |
|---|---|
| PubChem CID | 173217101 |
| Molecular Formula | C24H28ClNO5S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | methyl 2-[3-chloro-4-[3-[(3-methoxyimino-7-propyl-1-benzofuran-6-yl)oxy]propylsulfanyl]phenyl]acetate |
| SMILES | CCCc1c(OCCCSc2ccc(CC(=O)OC)cc2Cl)ccc2c1OCC2=NOC |
| InChI | InChI=1S/C24H28ClNO5S/c1-4-6-18-21(9-8-17-20(26-29-3)15-31-24(17)18)30-11-5-12-32-22-10-7-16(13-19(22)25)14-23(27)28-2/h7-10,13H,4-6,11-12,14-15H2,1-3H3 |
| InChIKey | OBRDLIOVYSDHDI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|