C25H32ClNO4S — CID 54351883
methyl 2-[3-chloro-4-[4-[3-hydroxy-4-(1-nitrosopropyl)-2-propylphenyl]butylsulfanyl]phenyl]acetate (PubChem CID 54351883) has the molecular formula C25H32ClNO4S and a molecular weight of 478.05 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-[4-[3-hydroxy-4-(1-nitrosopropyl)-2-propylphenyl]butylsulfanyl]phenyl]acetate.
| Compound Name | methyl 2-[3-chloro-4-[4-[3-hydroxy-4-(1-nitrosopropyl)-2-propylphenyl]butylsulfanyl]phenyl]acetate |
|---|---|
| PubChem CID | 54351883 |
| Molecular Formula | C25H32ClNO4S |
| Molecular Weight | 478.05 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | methyl 2-[3-chloro-4-[4-[3-hydroxy-4-(1-nitrosopropyl)-2-propylphenyl]butylsulfanyl]phenyl]acetate |
| SMILES | CCCc1c(CCCCSc2ccc(CC(=O)OC)cc2Cl)ccc(C(CC)N=O)c1O |
| InChI | InChI=1S/C25H32ClNO4S/c1-4-8-19-18(11-12-20(25(19)29)22(5-2)27-30)9-6-7-14-32-23-13-10-17(15-21(23)26)16-24(28)31-3/h10-13,15,22,29H,4-9,14,16H2,1-3H3 |
| InChIKey | UGIRYRLPFXFGCE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.05 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|