C25H30ClNO4S — CID 54347602
methyl 2-[3-chloro-4-[3-[(3,7-dipropyl-1,2-benzoxazol-6-yl)oxy]propylsulfanyl]phenyl]acetate (PubChem CID 54347602) has the molecular formula C25H30ClNO4S and a molecular weight of 476.04 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-[3-[(3,7-dipropyl-1,2-benzoxazol-6-yl)oxy]propylsulfanyl]phenyl]acetate.
| Compound Name | methyl 2-[3-chloro-4-[3-[(3,7-dipropyl-1,2-benzoxazol-6-yl)oxy]propylsulfanyl]phenyl]acetate |
|---|---|
| PubChem CID | 54347602 |
| Molecular Formula | C25H30ClNO4S |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | methyl 2-[3-chloro-4-[3-[(3,7-dipropyl-1,2-benzoxazol-6-yl)oxy]propylsulfanyl]phenyl]acetate |
| SMILES | CCCc1noc2c(CCC)c(OCCCSc3ccc(CC(=O)OC)cc3Cl)ccc12 |
| InChI | InChI=1S/C25H30ClNO4S/c1-4-7-19-22(11-10-18-21(8-5-2)27-31-25(18)19)30-13-6-14-32-23-12-9-17(15-20(23)26)16-24(28)29-3/h9-12,15H,4-8,13-14,16H2,1-3H3 |
| InChIKey | UDJSSMZLYLUENW-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|