C31H40O6S — CID 54050137
methyl 2-[4-[3-(4-tert-butyl-3,7-dihydroxy-2-oxo-8-propylchromen-5-yl)propylsulfanyl]-3-propylphenyl]acetate (PubChem CID 54050137) has the molecular formula C31H40O6S and a molecular weight of 540.72 g/mol. Its IUPAC name is methyl 2-[4-[3-(4-tert-butyl-3,7-dihydroxy-2-oxo-8-propylchromen-5-yl)propylsulfanyl]-3-propylphenyl]acetate.
| Compound Name | methyl 2-[4-[3-(4-tert-butyl-3,7-dihydroxy-2-oxo-8-propylchromen-5-yl)propylsulfanyl]-3-propylphenyl]acetate |
|---|---|
| PubChem CID | 54050137 |
| Molecular Formula | C31H40O6S |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | methyl 2-[4-[3-(4-tert-butyl-3,7-dihydroxy-2-oxo-8-propylchromen-5-yl)propylsulfanyl]-3-propylphenyl]acetate |
| SMILES | CCCc1cc(CC(=O)OC)ccc1SCCCc1cc(O)c(CCC)c2oc(=O)c(O)c(C(C)(C)C)c12 |
| InChI | InChI=1S/C31H40O6S/c1-7-10-20-16-19(17-25(33)36-6)13-14-24(20)38-15-9-12-21-18-23(32)22(11-8-2)29-26(21)27(31(3,4)5)28(34)30(35)37-29/h13-14,16,18,32,34H,7-12,15,17H2,1-6H3 |
| InChIKey | LSHMAKUANXOIBP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|