C23H26O6 — CID 13019320
(E)-3-[2-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]prop-2-enoic acid (PubChem CID 13019320) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is (E)-3-[2-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 13019320 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (E)-3-[2-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]phenyl]prop-2-enoic acid |
| SMILES | CCCc1c(OCCCOc2ccccc2/C=C/C(=O)O)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H26O6/c1-3-7-19-21(12-11-18(16(2)24)23(19)27)29-15-6-14-28-20-9-5-4-8-17(20)10-13-22(25)26/h4-5,8-13,27H,3,6-7,14-15H2,1-2H3,(H,25,26)/b13-10+ |
| InChIKey | CVKSRPMYMAHIGA-JLHYYAGUSA-N |
| XLogP | 4.49 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|